C18H33Cl2N3SiTi-2 — CID 58634731
carbanide;dichlorotitanium;(1S)-3-[dimethyl(piperazin-4-id-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine (PubChem CID 58634731) has the molecular formula C18H33Cl2N3SiTi-2 and a molecular weight of 438.34 g/mol. Its IUPAC name is carbanide;dichlorotitanium;(1S)-3-[dimethyl(piperazin-4-id-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine.
| Compound Name | carbanide;dichlorotitanium;(1S)-3-[dimethyl(piperazin-4-id-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 58634731 |
| Molecular Formula | C18H33Cl2N3SiTi-2 |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | carbanide;dichlorotitanium;(1S)-3-[dimethyl(piperazin-4-id-1-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine |
| SMILES | CN(C)[C@H]1CC([Si](C)(C)N2CC[N-]CC2)C2C=CC=CC21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C17H30N3Si.CH3.2ClH.Ti/c1-19(2)16-13-17(15-8-6-5-7-14(15)16)21(3,4)20-11-9-18-10-12-20;;;;/h5-8,14-17H,9-13H2,1-4H3;1H3;2*1H;/q2*-1;;;+2/p-2/t14?,15?,16-,17?;;;;/m0..../s1 |
| InChIKey | QYJMPZCYBUUATB-UVXJWPPESA-L |
| XLogP | 4.77 |
| TPSA | 20.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|