C23H35Cl2N3SiTi-2 — CID 58634863
carbanide;dichlorotitanium;(6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl)-dimethyl-piperazin-4-id-1-ylsilane (PubChem CID 58634863) has the molecular formula C23H35Cl2N3SiTi-2 and a molecular weight of 500.41 g/mol. Its IUPAC name is carbanide;dichlorotitanium;(6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl)-dimethyl-piperazin-4-id-1-ylsilane.
| Compound Name | carbanide;dichlorotitanium;(6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl)-dimethyl-piperazin-4-id-1-ylsilane |
|---|---|
| PubChem CID | 58634863 |
| Molecular Formula | C23H35Cl2N3SiTi-2 |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | carbanide;dichlorotitanium;(6-ethyl-4-phenyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-7-yl)-dimethyl-piperazin-4-id-1-ylsilane |
| SMILES | CCC1CC2C(c3ccccc3)=CC=NC2C1[Si](C)(C)N1CC[N-]CC1.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C22H32N3Si.CH3.2ClH.Ti/c1-4-17-16-20-19(18-8-6-5-7-9-18)10-11-24-21(20)22(17)26(2,3)25-14-12-23-13-15-25;;;;/h5-11,17,20-22H,4,12-16H2,1-3H3;1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | XABUSEBGEVSXAK-UHFFFAOYSA-L |
| XLogP | 6.66 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|