C20H35N3Si — CID 58634910
[(3R)-3-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(1,3,5-triazinan-1-yl)silane (PubChem CID 58634910) has the molecular formula C20H35N3Si and a molecular weight of 345.61 g/mol. Its IUPAC name is [(3R)-3-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(1,3,5-triazinan-1-yl)silane.
| Compound Name | [(3R)-3-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(1,3,5-triazinan-1-yl)silane |
|---|---|
| PubChem CID | 58634910 |
| Molecular Formula | C20H35N3Si |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 345.26 |
| IUPAC Name | [(3R)-3-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(1,3,5-triazinan-1-yl)silane |
| SMILES | C[Si](C)(C1C[C@H](C2CCCCC2)C2C=CC=CC21)N1CNCNC1 |
| InChI | InChI=1S/C20H35N3Si/c1-24(2,23-14-21-13-22-15-23)20-12-19(16-8-4-3-5-9-16)17-10-6-7-11-18(17)20/h6-7,10-11,16-22H,3-5,8-9,12-15H2,1-2H3/t17?,18?,19-,20?/m1/s1 |
| InChIKey | VPGJJGXQZLZGGB-WMGUDHAHSA-N |
| XLogP | 3.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|