C21H24ClN2O7S4+ — CID 58635095
4-[5-chloro-2-[[5-methyl-1-(3-sulfopropyl)furo[3,2-d][1,3]thiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 58635095) has the molecular formula C21H24ClN2O7S4+ and a molecular weight of 580.15 g/mol. Its IUPAC name is 4-[5-chloro-2-[[5-methyl-1-(3-sulfopropyl)furo[3,2-d][1,3]thiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-chloro-2-[[5-methyl-1-(3-sulfopropyl)furo[3,2-d][1,3]thiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58635095 |
| Molecular Formula | C21H24ClN2O7S4+ |
| Molecular Weight | 580.15 g/mol |
| Exact Mass | 579.01 |
| IUPAC Name | 4-[5-chloro-2-[[5-methyl-1-(3-sulfopropyl)furo[3,2-d][1,3]thiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | Cc1cc2c(o1)SC(=Cc1sc3ccc(Cl)cc3[n+]1CCCCS(=O)(=O)O)N2CCCS(=O)(=O)O |
| InChI | InChI=1S/C21H23ClN2O7S4/c1-14-11-17-21(31-14)33-20(24(17)8-4-10-35(28,29)30)13-19-23(7-2-3-9-34(25,26)27)16-12-15(22)5-6-18(16)32-19/h5-6,11-13H,2-4,7-10H2,1H3,(H-,25,26,27,28,29,30)/p+1 |
| InChIKey | VMDPULMCMIOXOZ-UHFFFAOYSA-O |
| XLogP | 4.60 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.15 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|