C22H21ClFN2O6S3+ — CID 58635114
2-[5-chloro-2-[2-[[5-fluoro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid (PubChem CID 58635114) has the molecular formula C22H21ClFN2O6S3+ and a molecular weight of 560.07 g/mol. Its IUPAC name is 2-[5-chloro-2-[2-[[5-fluoro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-[2-[[5-fluoro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid |
|---|---|
| PubChem CID | 58635114 |
| Molecular Formula | C22H21ClFN2O6S3+ |
| Molecular Weight | 560.07 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | 2-[5-chloro-2-[2-[[5-fluoro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid |
| SMILES | CCC(=Cc1sc2cc(Cl)sc2[n+]1CC(=O)O)C=C1Oc2ccc(F)cc2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C22H20ClFN2O6S3/c1-2-13(9-20-26(12-21(27)28)22-17(33-20)11-18(23)34-22)8-19-25(6-3-7-35(29,30)31)15-10-14(24)4-5-16(15)32-19/h4-5,8-11H,2-3,6-7,12H2,1H3,(H-,27,28,29,30,31)/p+1 |
| InChIKey | VHSJWVZIRYOKRL-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.07 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|