C19H17Cl2N2O7S2+ — CID 58635118
2-[5-chloro-2-[[5-chloro-3-(4-sulfobutyl)-1,3-benzoxazol-2-ylidene]methyl]furo[3,2-d][1,3]thiazol-1-ium-1-yl]acetic acid (PubChem CID 58635118) has the molecular formula C19H17Cl2N2O7S2+ and a molecular weight of 520.39 g/mol. Its IUPAC name is 2-[5-chloro-2-[[5-chloro-3-(4-sulfobutyl)-1,3-benzoxazol-2-ylidene]methyl]furo[3,2-d][1,3]thiazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-[[5-chloro-3-(4-sulfobutyl)-1,3-benzoxazol-2-ylidene]methyl]furo[3,2-d][1,3]thiazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 58635118 |
| Molecular Formula | C19H17Cl2N2O7S2+ |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 518.98 |
| IUPAC Name | 2-[5-chloro-2-[[5-chloro-3-(4-sulfobutyl)-1,3-benzoxazol-2-ylidene]methyl]furo[3,2-d][1,3]thiazol-1-ium-1-yl]acetic acid |
| SMILES | O=C(O)C[n+]1c(C=C2Oc3ccc(Cl)cc3N2CCCCS(=O)(=O)O)sc2oc(Cl)cc21 |
| InChI | InChI=1S/C19H16Cl2N2O7S2/c20-11-3-4-14-12(7-11)22(5-1-2-6-32(26,27)28)16(29-14)9-17-23(10-18(24)25)13-8-15(21)30-19(13)31-17/h3-4,7-9H,1-2,5-6,10H2,(H-,24,25,26,27,28)/p+1 |
| InChIKey | MRTPTXWXCOBZSY-UHFFFAOYSA-O |
| XLogP | 4.04 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|