C20H20ClN3O8S4 — CID 58635134
4-[2-[[1-(acetylsulfamoylmethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-hydroxy-1,3-benzothiazol-3-yl]butane-1-sulfonate (PubChem CID 58635134) has the molecular formula C20H20ClN3O8S4 and a molecular weight of 594.11 g/mol. Its IUPAC name is 4-[2-[[1-(acetylsulfamoylmethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-hydroxy-1,3-benzothiazol-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[[1-(acetylsulfamoylmethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-hydroxy-1,3-benzothiazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 58635134 |
| Molecular Formula | C20H20ClN3O8S4 |
| Molecular Weight | 594.11 g/mol |
| Exact Mass | 592.98 |
| IUPAC Name | 4-[2-[[1-(acetylsulfamoylmethyl)-5-chlorofuro[3,2-d][1,3]thiazol-1-ium-2-yl]methylidene]-5-hydroxy-1,3-benzothiazol-3-yl]butane-1-sulfonate |
| SMILES | CC(=O)NS(=O)(=O)C[n+]1c(C=C2Sc3ccc(O)cc3N2CCCCS(=O)(=O)[O-])sc2oc(Cl)cc21 |
| InChI | InChI=1S/C20H20ClN3O8S4/c1-12(25)22-35(27,28)11-24-15-9-17(21)32-20(15)34-19(24)10-18-23(6-2-3-7-36(29,30)31)14-8-13(26)4-5-16(14)33-18/h4-5,8-10H,2-3,6-7,11H2,1H3,(H2-,22,25,26,29,30,31) |
| InChIKey | PGOKKEPXFAAHJM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.11 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|