C22H21Cl2N2O6S3+ — CID 58635166
2-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]acetic acid (PubChem CID 58635166) has the molecular formula C22H21Cl2N2O6S3+ and a molecular weight of 576.53 g/mol. Its IUPAC name is 2-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 58635166 |
| Molecular Formula | C22H21Cl2N2O6S3+ |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 574.99 |
| IUPAC Name | 2-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]acetic acid |
| SMILES | CCC(=Cc1sc2cc(Cl)sc2[n+]1CCCS(=O)(=O)O)C=C1Oc2ccc(Cl)cc2N1CC(=O)O |
| InChI | InChI=1S/C22H20Cl2N2O6S3/c1-2-13(8-19-26(12-21(27)28)15-10-14(23)4-5-16(15)32-19)9-20-25(6-3-7-35(29,30)31)22-17(33-20)11-18(24)34-22/h4-5,8-11H,2-3,6-7,12H2,1H3,(H-,27,28,29,30,31)/p+1 |
| InChIKey | MRBJSXIJDSLRBC-UHFFFAOYSA-O |
| XLogP | 5.45 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|