C31H43F2N5O3 — CID 58635365
(3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 58635365) has the molecular formula C31H43F2N5O3 and a molecular weight of 571.71 g/mol. Its IUPAC name is (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 58635365 |
| Molecular Formula | C31H43F2N5O3 |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@@H]([C@H](O)C2CCCCC2)NC(=O)C12CCN(Cc1c(C)nn(-c3ccc(F)cc3F)c1C)CC2 |
| InChI | InChI=1S/C31H43F2N5O3/c1-4-5-15-37-29(40)27(28(39)22-9-7-6-8-10-22)34-30(41)31(37)13-16-36(17-14-31)19-24-20(2)35-38(21(24)3)26-12-11-23(32)18-25(26)33/h11-12,18,22,27-28,39H,4-10,13-17,19H2,1-3H3,(H,34,41)/t27-,28-/m1/s1 |
| InChIKey | UBPRJVMYDOUIGB-VSGBNLITSA-N |
| XLogP | 4.17 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |