About chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate
chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate (PubChem CID 58635686) has the molecular formula C19H14ClCuNS
and a molecular weight of 387.39 g/mol. Its IUPAC name is chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate.
Molecular Properties
| Compound Name | chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate |
| PubChem CID | 58635686 |
| Molecular Formula | C19H14ClCuNS |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate |
| SMILES | Cl[Cu+].[S-]c1c(/C=N/c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C19H15NS.ClH.Cu/c21-19-16(14-20-17-11-5-2-6-12-17)10-7-13-18(19)15-8-3-1-4-9-15;;/h1-14,21H;1H;/q;;+2/p-2/b20-14+;; |
| InChIKey | ZEYWHSDWUKJLLY-WNQUAZRHSA-L |
| XLogP | 5.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate?
The IUPAC name of chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate (CID 58635686) is chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate.
What is the SMILES notation for chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate?
The canonical SMILES for chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate is Cl[Cu+].[S-]c1c(/C=N/c2ccccc2)cccc1-c1ccccc1.
What is the InChIKey of chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate?
The InChIKey is ZEYWHSDWUKJLLY-WNQUAZRHSA-L. The full InChI is InChI=1S/C19H15NS.ClH.Cu/c21-19-16(14-20-17-11-5-2-6-12-17)10-7-13-18(19)15-8-3-1-4-9-15;;/h1-14,21H;1H;/q;;+2/p-2/b20-14+;;.
What are the key properties of chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate?
chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate has a molecular weight of 387.39 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorocopper(1+);2-phenyl-6-(phenyliminomethyl)benzenethiolate is sourced from PubChem (CID 58635686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).