About 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+)
2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) (PubChem CID 58635707) has the molecular formula C24H26Br2CrNS
and a molecular weight of 572.35 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+).
Molecular Properties
| Compound Name | 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) |
| PubChem CID | 58635707 |
| Molecular Formula | C24H26Br2CrNS |
| Molecular Weight | 572.35 g/mol |
| Exact Mass | 569.96 |
| IUPAC Name | 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) |
| SMILES | Br[Cr+]Br.Cc1cc(/C=N/c2ccccc2)c([S-])c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H27NS.2BrH.Cr/c1-16-7-20(15-25-21-5-3-2-4-6-21)23(26)22(8-16)24-12-17-9-18(13-24)11-19(10-17)14-24;;;/h2-8,15,17-19,26H,9-14H2,1H3;2*1H;/q;;;+3/p-3/b25-15+;;; |
| InChIKey | RWIPNTOKOFKBHU-OHZIUJLBSA-K |
| XLogP | 7.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.35 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+)?
The IUPAC name of 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) (CID 58635707) is 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+).
What is the SMILES notation for 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+)?
The canonical SMILES for 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) is Br[Cr+]Br.Cc1cc(/C=N/c2ccccc2)c([S-])c(C23CC4CC(CC(C4)C2)C3)c1.
What is the InChIKey of 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+)?
The InChIKey is RWIPNTOKOFKBHU-OHZIUJLBSA-K. The full InChI is InChI=1S/C24H27NS.2BrH.Cr/c1-16-7-20(15-25-21-5-3-2-4-6-21)23(26)22(8-16)24-12-17-9-18(13-24)11-19(10-17)14-24;;;/h2-8,15,17-19,26H,9-14H2,1H3;2*1H;/q;;;+3/p-3/b25-15+;;;.
What are the key properties of 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+)?
2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) has a molecular weight of 572.35 g/mol, XLogP of 7.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-4-methyl-6-(phenyliminomethyl)benzenethiolate;dibromochromium(1+) is sourced from PubChem (CID 58635707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).