C19H18O6 — CID 58635811
[2-[(1S,3S,4S)-7-hydroxy-1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]phenyl] benzoate (PubChem CID 58635811) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is [2-[(1S,3S,4S)-7-hydroxy-1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]phenyl] benzoate.
| Compound Name | [2-[(1S,3S,4S)-7-hydroxy-1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 58635811 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [2-[(1S,3S,4S)-7-hydroxy-1-(hydroxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccccc1[C@@H]1O[C@@]2(CO)CO[C@H]1C2O)c1ccccc1 |
| InChI | InChI=1S/C19H18O6/c20-10-19-11-23-16(17(19)21)15(25-19)13-8-4-5-9-14(13)24-18(22)12-6-2-1-3-7-12/h1-9,15-17,20-21H,10-11H2/t15-,16+,17?,19-/m0/s1 |
| InChIKey | VSGDAYPJBUGALX-RZRMAFQFSA-N |
| XLogP | 1.47 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|