C9H14BO4S — CID 58635913
CID 58635913 (PubChem CID 58635913) has the molecular formula C9H14BO4S and a molecular weight of 231.09 g/mol.
| Compound Name | CID 58635913 |
|---|---|
| PubChem CID | 58635913 |
| Molecular Formula | C9H14BO4S |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | — |
| SMILES | [3H][B]SOCC1=C[C@@H](O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C9H14BO4S/c1-9(2)13-7-5(4-12-15-10)3-6(11)8(7)14-9/h3,6-8,10-11H,4H2,1-2H3/t6-,7-,8+/m1/s1/i10T |
| InChIKey | MSZGOZOSANMURP-UXGOXPDDSA-N |
| XLogP | 0.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|