About N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine
N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine (PubChem CID 58636011) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine |
| PubChem CID | 58636011 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine |
| SMILES | CCN(C)c1nc(OC)ccc1C |
| InChI | InChI=1S/C10H16N2O/c1-5-12(3)10-8(2)6-7-9(11-10)13-4/h6-7H,5H2,1-4H3 |
| InChIKey | DLCZCQRBKVFGFF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine?
The IUPAC name of N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine (CID 58636011) is N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine.
What is the SMILES notation for N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine?
The canonical SMILES for N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine is CCN(C)c1nc(OC)ccc1C.
What is the InChIKey of N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine?
The InChIKey is DLCZCQRBKVFGFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-5-12(3)10-8(2)6-7-9(11-10)13-4/h6-7H,5H2,1-4H3.
What are the key properties of N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine?
N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine has a molecular weight of 180.25 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-methoxy-N,3-dimethylpyridin-2-amine is sourced from PubChem (CID 58636011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).