C13H22N4O6 — CID 58636321
6,7-dimethyl-8-(2,3,4,5-tetrahydroxypentyl)-4a,5,6,7-tetrahydropteridine-2,4-dione (PubChem CID 58636321) has the molecular formula C13H22N4O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 6,7-dimethyl-8-(2,3,4,5-tetrahydroxypentyl)-4a,5,6,7-tetrahydropteridine-2,4-dione.
| Compound Name | 6,7-dimethyl-8-(2,3,4,5-tetrahydroxypentyl)-4a,5,6,7-tetrahydropteridine-2,4-dione |
|---|---|
| PubChem CID | 58636321 |
| Molecular Formula | C13H22N4O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6,7-dimethyl-8-(2,3,4,5-tetrahydroxypentyl)-4a,5,6,7-tetrahydropteridine-2,4-dione |
| SMILES | CC1NC2C(=O)NC(=O)N=C2N(CC(O)C(O)C(O)CO)C1C |
| InChI | InChI=1S/C13H22N4O6/c1-5-6(2)17(3-7(19)10(21)8(20)4-18)11-9(14-5)12(22)16-13(23)15-11/h5-10,14,18-21H,3-4H2,1-2H3,(H,16,22,23) |
| InChIKey | HOJNQTQGJJJLRM-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |