C9H15NO3 — CID 58636709
ethyl 2-(cyclopropanecarbonylamino)propanoate (PubChem CID 58636709) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is ethyl 2-(cyclopropanecarbonylamino)propanoate.
| Compound Name | ethyl 2-(cyclopropanecarbonylamino)propanoate |
|---|---|
| PubChem CID | 58636709 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | ethyl 2-(cyclopropanecarbonylamino)propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)C1CC1 |
| InChI | InChI=1S/C9H15NO3/c1-3-13-9(12)6(2)10-8(11)7-4-5-7/h6-7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | VJDXPAAFWFJYQN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |