C19H22O — CID 58637005
4,5,10,14-tetramethyltetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one (PubChem CID 58637005) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 4,5,10,14-tetramethyltetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one.
| Compound Name | 4,5,10,14-tetramethyltetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
|---|---|
| PubChem CID | 58637005 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4,5,10,14-tetramethyltetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
| SMILES | CC1=C2c3ccc(C)c(C)c3CC23CC(CC3C)C1=O |
| InChI | InChI=1S/C19H22O/c1-10-5-6-15-16(12(10)3)9-19-8-14(7-11(19)2)18(20)13(4)17(15)19/h5-6,11,14H,7-9H2,1-4H3 |
| InChIKey | IVJOUUGIJPJQLF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |