C35H31F5OS — CID 58637485
1-ethoxy-4-[4-[4-[4-[2-(4-ethylsulfanyl-2,6-difluorophenyl)ethynyl]-3,5-difluorophenyl]phenyl]butyl]-2-fluoro-5-methylbenzene (PubChem CID 58637485) has the molecular formula C35H31F5OS and a molecular weight of 594.69 g/mol. Its IUPAC name is 1-ethoxy-4-[4-[4-[4-[2-(4-ethylsulfanyl-2,6-difluorophenyl)ethynyl]-3,5-difluorophenyl]phenyl]butyl]-2-fluoro-5-methylbenzene.
| Compound Name | 1-ethoxy-4-[4-[4-[4-[2-(4-ethylsulfanyl-2,6-difluorophenyl)ethynyl]-3,5-difluorophenyl]phenyl]butyl]-2-fluoro-5-methylbenzene |
|---|---|
| PubChem CID | 58637485 |
| Molecular Formula | C35H31F5OS |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 1-ethoxy-4-[4-[4-[4-[2-(4-ethylsulfanyl-2,6-difluorophenyl)ethynyl]-3,5-difluorophenyl]phenyl]butyl]-2-fluoro-5-methylbenzene |
| SMILES | CCOc1cc(C)c(CCCCc2ccc(-c3cc(F)c(C#Cc4c(F)cc(SCC)cc4F)c(F)c3)cc2)cc1F |
| InChI | InChI=1S/C35H31F5OS/c1-4-41-35-16-22(3)25(17-34(35)40)9-7-6-8-23-10-12-24(13-11-23)26-18-30(36)28(31(37)19-26)14-15-29-32(38)20-27(42-5-2)21-33(29)39/h10-13,16-21H,4-9H2,1-3H3 |
| InChIKey | UKHUNUCJIMADFW-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|