About 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane
4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane (PubChem CID 58637717) has the molecular formula C9H14F2O
and a molecular weight of 176.21 g/mol. Its IUPAC name is 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane.
Analyze 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane?
The IUPAC name of 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane (CID 58637717) is 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane.
What is the SMILES notation for 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane?
The canonical SMILES for 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane is C=C1OC(C)(C)C(C)(C)C1(F)F.
What is the InChIKey of 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane?
The InChIKey is ABDFPKMYSZLPFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O/c1-6-9(10,11)7(2,3)8(4,5)12-6/h1H2,2-5H3.
What are the key properties of 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane?
4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane has a molecular weight of 176.21 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-2,2,3,3-tetramethyl-5-methylideneoxolane is sourced from PubChem (CID 58637717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).