C22H25NO6S2 — CID 58637842
3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)inden-1-yl]propane-1-sulfonic acid (PubChem CID 58637842) has the molecular formula C22H25NO6S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)inden-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)inden-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58637842 |
| Molecular Formula | C22H25NO6S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-(trioxidanylsulfanyl)inden-1-yl]propane-1-sulfonic acid |
| SMILES | CC1(C)C(/C=C/Nc2ccccc2)=C(CCCS(=O)(=O)O)c2ccc(SOOO)cc21 |
| InChI | InChI=1S/C22H25NO6S2/c1-22(2)20(12-13-23-16-7-4-3-5-8-16)18(9-6-14-31(25,26)27)19-11-10-17(15-21(19)22)30-29-28-24/h3-5,7-8,10-13,15,23-24H,6,9,14H2,1-2H3,(H,25,26,27)/b13-12+ |
| InChIKey | UMBNOYJBGDSUKO-OUKQBFOZSA-N |
| XLogP | 5.45 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|