C22H21N2O3S+ — CID 58637898
(6Z)-7-ethyl-6-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole (PubChem CID 58637898) has the molecular formula C22H21N2O3S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is (6Z)-7-ethyl-6-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
| Compound Name | (6Z)-7-ethyl-6-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 58637898 |
| Molecular Formula | C22H21N2O3S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (6Z)-7-ethyl-6-[(E)-3-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)prop-2-enylidene]-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| SMILES | CCN1/C(=C/C=C/c2oc3ccccc3[n+]2CC)Sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C22H21N2O3S/c1-3-23-15-8-5-6-9-17(15)27-21(23)10-7-11-22-24(4-2)16-12-18-19(26-14-25-18)13-20(16)28-22/h5-13H,3-4,14H2,1-2H3/q+1 |
| InChIKey | XEKJXJPWSDUWFR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|