C16H21N3O3 — CID 58638505
6-(3,6-dihydro-2H-pyran-4-yl)-2-(4-methylpiperidin-1-yl)-3-nitropyridine (PubChem CID 58638505) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyran-4-yl)-2-(4-methylpiperidin-1-yl)-3-nitropyridine.
| Compound Name | 6-(3,6-dihydro-2H-pyran-4-yl)-2-(4-methylpiperidin-1-yl)-3-nitropyridine |
|---|---|
| PubChem CID | 58638505 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyran-4-yl)-2-(4-methylpiperidin-1-yl)-3-nitropyridine |
| SMILES | CC1CCN(c2nc(C3=CCOCC3)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H21N3O3/c1-12-4-8-18(9-5-12)16-15(19(20)21)3-2-14(17-16)13-6-10-22-11-7-13/h2-3,6,12H,4-5,7-11H2,1H3 |
| InChIKey | USTSOTBNIJLGHX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|