About N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline
N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline (PubChem CID 58639259) has the molecular formula C13H13F3N2S2
and a molecular weight of 318.39 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline |
| PubChem CID | 58639259 |
| Molecular Formula | C13H13F3N2S2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline |
| SMILES | CCC(Nc1ccc(C(F)(F)F)cc1)Sc1nccs1 |
| InChI | InChI=1S/C13H13F3N2S2/c1-2-11(20-12-17-7-8-19-12)18-10-5-3-9(4-6-10)13(14,15)16/h3-8,11,18H,2H2,1H3 |
| InChIKey | DYOVFXSEYPGWBQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline?
The IUPAC name of N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline (CID 58639259) is N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline.
What is the SMILES notation for N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline?
The canonical SMILES for N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline is CCC(Nc1ccc(C(F)(F)F)cc1)Sc1nccs1.
What is the InChIKey of N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline?
The InChIKey is DYOVFXSEYPGWBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2S2/c1-2-11(20-12-17-7-8-19-12)18-10-5-3-9(4-6-10)13(14,15)16/h3-8,11,18H,2H2,1H3.
What are the key properties of N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline?
N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline has a molecular weight of 318.39 g/mol, XLogP of 5.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-thiazol-2-ylsulfanyl)propyl]-4-(trifluoromethyl)aniline is sourced from PubChem (CID 58639259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).