C23H24N2O2 — CID 58639394
N-(3-tert-butylphenyl)-6-(3-methoxyphenyl)pyridine-3-carboxamide (PubChem CID 58639394) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(3-tert-butylphenyl)-6-(3-methoxyphenyl)pyridine-3-carboxamide.
| Compound Name | N-(3-tert-butylphenyl)-6-(3-methoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58639394 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-(3-tert-butylphenyl)-6-(3-methoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1cccc(-c2ccc(C(=O)Nc3cccc(C(C)(C)C)c3)cn2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-23(2,3)18-8-6-9-19(14-18)25-22(26)17-11-12-21(24-15-17)16-7-5-10-20(13-16)27-4/h5-15H,1-4H3,(H,25,26) |
| InChIKey | GKIVZSXUJOGKEL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |