C11H21BSeSi — CID 586399
4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1,2,5-selenasilaborole (PubChem CID 586399) has the molecular formula C11H21BSeSi and a molecular weight of 271.15 g/mol. Its IUPAC name is 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1,2,5-selenasilaborole.
| Compound Name | 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1,2,5-selenasilaborole |
|---|---|
| PubChem CID | 586399 |
| Molecular Formula | C11H21BSeSi |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4,5-diethyl-2,2-dimethyl-3-prop-1-en-2-yl-1,2,5-selenasilaborole |
| SMILES | C=C(C)C1=C(CC)B(CC)[Se][Si]1(C)C |
| InChI | InChI=1S/C11H21BSeSi/c1-7-10-11(9(3)4)14(5,6)13-12(10)8-2/h3,7-8H2,1-2,4-6H3 |
| InChIKey | QVWUKVFZPFUSHW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|