C30H31N3O4S — CID 58640279
N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-5-phenylthiophene-2-carboxamide (PubChem CID 58640279) has the molecular formula C30H31N3O4S and a molecular weight of 529.66 g/mol. Its IUPAC name is N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-5-phenylthiophene-2-carboxamide.
| Compound Name | N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 58640279 |
| Molecular Formula | C30H31N3O4S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-5-phenylthiophene-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2ccccc2)s1)C(=O)N1CC[C@@H]2[C@H]1C(=O)CN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H31N3O4S/c1-19(2)17-22(31-28(35)26-14-13-25(38-26)20-9-5-3-6-10-20)30(37)32-16-15-23-27(32)24(34)18-33(23)29(36)21-11-7-4-8-12-21/h3-14,19,22-23,27H,15-18H2,1-2H3,(H,31,35)/t22-,23+,27-/m0/s1 |
| InChIKey | SRGLDKNCAQAMMB-OBTVHEKISA-N |
| XLogP | 4.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |