About [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite
[6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite (PubChem CID 58640365) has the molecular formula C35H28N4O8P2
and a molecular weight of 694.58 g/mol. Its IUPAC name is [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite.
Molecular Properties
| Compound Name | [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite |
| PubChem CID | 58640365 |
| Molecular Formula | C35H28N4O8P2 |
| Molecular Weight | 694.58 g/mol |
| Exact Mass | 694.14 |
| IUPAC Name | [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite |
| SMILES | COc1ccc(C(=O)c2ccccc2OP(Oc2ccccn2)Oc2ccccn2)c(OP(Oc2ccccn2)Oc2ccccn2)c1C |
| InChI | InChI=1S/C35H28N4O8P2/c1-25-28(41-2)20-19-27(35(25)47-49(45-32-17-7-11-23-38-32)46-33-18-8-12-24-39-33)34(40)26-13-3-4-14-29(26)42-48(43-30-15-5-9-21-36-30)44-31-16-6-10-22-37-31/h3-24H,1-2H3 |
| InChIKey | VIAQOUBMFQIRBJ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 133.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 694.58 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite?
The IUPAC name of [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite (CID 58640365) is [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite.
What is the SMILES notation for [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite?
The canonical SMILES for [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite is COc1ccc(C(=O)c2ccccc2OP(Oc2ccccn2)Oc2ccccn2)c(OP(Oc2ccccn2)Oc2ccccn2)c1C.
What is the InChIKey of [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite?
The InChIKey is VIAQOUBMFQIRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H28N4O8P2/c1-25-28(41-2)20-19-27(35(25)47-49(45-32-17-7-11-23-38-32)46-33-18-8-12-24-39-33)34(40)26-13-3-4-14-29(26)42-48(43-30-15-5-9-21-36-30)44-31-16-6-10-22-37-31/h3-24H,1-2H3.
What are the key properties of [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite?
[6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite has a molecular weight of 694.58 g/mol, XLogP of 8.34, 15 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)-3-methoxy-2-methylphenyl] dipyridin-2-yl phosphite is sourced from PubChem (CID 58640365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).