C19H27F3O3 — CID 58640840
(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 58640840) has the molecular formula C19H27F3O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is (5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | (5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 58640840 |
| Molecular Formula | C19H27F3O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(CC(C)(O)C(F)(F)F)OC(=O)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C19H27F3O3/c1-9(8-18(2,24)19(20,21)22)25-17(23)14-7-12-6-13(14)16-11-4-3-10(5-11)15(12)16/h9-16,24H,3-8H2,1-2H3 |
| InChIKey | IBOKZPAKVXWDKB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|