C21H24F12O6 — CID 58640845
bis[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 58640845) has the molecular formula C21H24F12O6 and a molecular weight of 600.39 g/mol. Its IUPAC name is bis[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | bis[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 58640845 |
| Molecular Formula | C21H24F12O6 |
| Molecular Weight | 600.39 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | bis[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | O=C(OCCCC(O)(C(F)(F)F)C(F)(F)F)C1C2CCC(C2)C1C(=O)OCCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H24F12O6/c22-18(23,24)16(36,19(25,26)27)5-1-7-38-14(34)12-10-3-4-11(9-10)13(12)15(35)39-8-2-6-17(37,20(28,29)30)21(31,32)33/h10-13,36-37H,1-9H2 |
| InChIKey | IIICNPFXZKBNJX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|