C18H26F6O4 — CID 58640846
[5,5,5-trifluoro-4-(2-methoxypropan-2-yloxy)-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58640846) has the molecular formula C18H26F6O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is [5,5,5-trifluoro-4-(2-methoxypropan-2-yloxy)-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [5,5,5-trifluoro-4-(2-methoxypropan-2-yloxy)-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58640846 |
| Molecular Formula | C18H26F6O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [5,5,5-trifluoro-4-(2-methoxypropan-2-yloxy)-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(C)(C)OC(CCCOC(=O)C1CC2CCC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H26F6O4/c1-15(2,26-3)28-16(17(19,20)21,18(22,23)24)7-4-8-27-14(25)13-10-11-5-6-12(13)9-11/h11-13H,4-10H2,1-3H3 |
| InChIKey | WSJOVJDFYQEDDX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|