C27H36F12O6 — CID 58640848
bis[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 58640848) has the molecular formula C27H36F12O6 and a molecular weight of 684.55 g/mol. Its IUPAC name is bis[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | bis[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 58640848 |
| Molecular Formula | C27H36F12O6 |
| Molecular Weight | 684.55 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | bis[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | O=C(OCCCCCCC(O)(C(F)(F)F)C(F)(F)F)C1C2CCC(C2)C1C(=O)OCCCCCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H36F12O6/c28-24(29,30)22(42,25(31,32)33)11-5-1-3-7-13-44-20(40)18-16-9-10-17(15-16)19(18)21(41)45-14-8-4-2-6-12-23(43,26(34,35)36)27(37,38)39/h16-19,42-43H,1-15H2 |
| InChIKey | LXYUPKXNPYMHNM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|