About [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate
[4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58640853) has the molecular formula C18H26F6O4
and a molecular weight of 420.39 g/mol. Its IUPAC name is [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 58640853 |
| Molecular Formula | C18H26F6O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(C)OC(CCCOC(=O)C1CC2CCC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H26F6O4/c1-3-26-11(2)28-16(17(19,20)21,18(22,23)24)7-4-8-27-15(25)14-10-12-5-6-13(14)9-12/h11-14H,3-10H2,1-2H3 |
| InChIKey | KDKMJVIKDFJRRD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate (CID 58640853) is [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate is CCOC(C)OC(CCCOC(=O)C1CC2CCC1C2)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is KDKMJVIKDFJRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F6O4/c1-3-26-11(2)28-16(17(19,20)21,18(22,23)24)7-4-8-27-15(25)14-10-12-5-6-13(14)9-12/h11-14H,3-10H2,1-2H3.
What are the key properties of [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate?
[4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 420.39 g/mol, XLogP of 5.01, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-ethoxyethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pentyl] bicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 58640853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).