C30H36N3+ — CID 58641007
N,N,3-trimethyl-4-[(Z)-(1-methyl-3,4-dihydro-2H-quinolin-1-ium-6-ylidene)-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline (PubChem CID 58641007) has the molecular formula C30H36N3+ and a molecular weight of 438.64 g/mol. Its IUPAC name is N,N,3-trimethyl-4-[(Z)-(1-methyl-3,4-dihydro-2H-quinolin-1-ium-6-ylidene)-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline.
| Compound Name | N,N,3-trimethyl-4-[(Z)-(1-methyl-3,4-dihydro-2H-quinolin-1-ium-6-ylidene)-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline |
|---|---|
| PubChem CID | 58641007 |
| Molecular Formula | C30H36N3+ |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | N,N,3-trimethyl-4-[(Z)-(1-methyl-3,4-dihydro-2H-quinolin-1-ium-6-ylidene)-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline |
| SMILES | Cc1cc(N(C)C)ccc1/C(c1ccc2c(c1)CCCN2C)=c1/ccc2c(c1)CCC[N+]=2C |
| InChI | InChI=1S/C30H36N3/c1-21-18-26(31(2)3)12-13-27(21)30(24-10-14-28-22(19-24)8-6-16-32(28)4)25-11-15-29-23(20-25)9-7-17-33(29)5/h10-15,18-20H,6-9,16-17H2,1-5H3/q+1 |
| InChIKey | CZKZVRGXJJACPK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|