C23H26FN7O3 — CID 58641483
N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-8-methyl-4-oxospiro[6,7-dihydropyrazino[1,2-a]pyrimidine-9,1'-cyclohexane]-2-carboxamide (PubChem CID 58641483) has the molecular formula C23H26FN7O3 and a molecular weight of 467.51 g/mol. Its IUPAC name is N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-8-methyl-4-oxospiro[6,7-dihydropyrazino[1,2-a]pyrimidine-9,1'-cyclohexane]-2-carboxamide.
| Compound Name | N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-8-methyl-4-oxospiro[6,7-dihydropyrazino[1,2-a]pyrimidine-9,1'-cyclohexane]-2-carboxamide |
|---|---|
| PubChem CID | 58641483 |
| Molecular Formula | C23H26FN7O3 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-8-methyl-4-oxospiro[6,7-dihydropyrazino[1,2-a]pyrimidine-9,1'-cyclohexane]-2-carboxamide |
| SMILES | CN1CCn2c(nc(C(=O)NCc3ccc(F)cc3-n3cncn3)c(O)c2=O)C12CCCCC2 |
| InChI | InChI=1S/C23H26FN7O3/c1-29-9-10-30-21(34)19(32)18(28-22(30)23(29)7-3-2-4-8-23)20(33)26-12-15-5-6-16(24)11-17(15)31-14-25-13-27-31/h5-6,11,13-14,32H,2-4,7-10,12H2,1H3,(H,26,33) |
| InChIKey | UENSVLDSNNYUNR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |