C16H14FN3O2S — CID 58641598
4-ethylsulfinyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),8,14,16-hexaen-11-one (PubChem CID 58641598) has the molecular formula C16H14FN3O2S and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-ethylsulfinyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),8,14,16-hexaen-11-one.
| Compound Name | 4-ethylsulfinyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),8,14,16-hexaen-11-one |
|---|---|
| PubChem CID | 58641598 |
| Molecular Formula | C16H14FN3O2S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-ethylsulfinyl-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),8,14,16-hexaen-11-one |
| SMILES | CCS(=O)C1Nc2c(c3cc[nH]c(=O)c3c3cc(F)ccc23)N1 |
| InChI | InChI=1S/C16H14FN3O2S/c1-2-23(22)16-19-13-9-4-3-8(17)7-11(9)12-10(14(13)20-16)5-6-18-15(12)21/h3-7,16,19-20H,2H2,1H3,(H,18,21) |
| InChIKey | NBQVYZZDPIZEDG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|