C25H45NO6S2Si — CID 58641984
[(2S,3S)-2-[(4S)-5-hydroxy-4-methylpentyl]-3-[(E,2S)-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]methyl methanesulfonate (PubChem CID 58641984) has the molecular formula C25H45NO6S2Si and a molecular weight of 547.86 g/mol. Its IUPAC name is [(2S,3S)-2-[(4S)-5-hydroxy-4-methylpentyl]-3-[(E,2S)-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,3S)-2-[(4S)-5-hydroxy-4-methylpentyl]-3-[(E,2S)-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 58641984 |
| Molecular Formula | C25H45NO6S2Si |
| Molecular Weight | 547.86 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | [(2S,3S)-2-[(4S)-5-hydroxy-4-methylpentyl]-3-[(E,2S)-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)-2-triethylsilyloxybut-3-enyl]oxiran-2-yl]methyl methanesulfonate |
| SMILES | CC[Si](CC)(CC)O[C@@H](C[C@@H]1O[C@@]1(CCC[C@H](C)CO)COS(C)(=O)=O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C25H45NO6S2Si/c1-8-35(9-2,10-3)32-23(20(5)14-22-17-33-21(6)26-22)15-24-25(31-24,18-30-34(7,28)29)13-11-12-19(4)16-27/h14,17,19,23-24,27H,8-13,15-16,18H2,1-7H3/b20-14+/t19-,23-,24-,25-/m0/s1 |
| InChIKey | SMKVTVDUVISQPV-GLPWZAHLSA-N |
| XLogP | 5.55 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|