C23H15F2N3O4S3 — CID 58644103
5-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylic acid (PubChem CID 58644103) has the molecular formula C23H15F2N3O4S3 and a molecular weight of 531.59 g/mol. Its IUPAC name is 5-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 58644103 |
| Molecular Formula | C23H15F2N3O4S3 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | 5-[3-[(5Z)-5-[[4-(3,4-difluorophenyl)thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cs2)SC1=S)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C23H15F2N3O4S3/c24-17-2-1-12(7-18(17)25)14-6-16(34-11-14)8-19-21(30)28(23(33)35-19)4-3-20(29)27-15-5-13(22(31)32)9-26-10-15/h1-2,5-11H,3-4H2,(H,27,29)(H,31,32)/b19-8- |
| InChIKey | RJKQOMRETAPUCZ-UWVJOHFNSA-N |
| XLogP | 5.02 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|