C26H17F6N3O4S3 — CID 58644639
methyl 6-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylate (PubChem CID 58644639) has the molecular formula C26H17F6N3O4S3 and a molecular weight of 645.63 g/mol. Its IUPAC name is methyl 6-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylate.
| Compound Name | methyl 6-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 58644639 |
| Molecular Formula | C26H17F6N3O4S3 |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 645.03 |
| IUPAC Name | methyl 6-[3-[(5Z)-5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C/c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cs3)SC2=S)nc1 |
| InChI | InChI=1S/C26H17F6N3O4S3/c1-39-23(38)13-2-3-20(33-11-13)34-21(36)4-5-35-22(37)19(42-24(35)40)10-18-8-15(12-41-18)14-6-16(25(27,28)29)9-17(7-14)26(30,31)32/h2-3,6-12H,4-5H2,1H3,(H,33,34,36)/b19-10- |
| InChIKey | WTHMEPBBQIOPJY-GRSHGNNSSA-N |
| XLogP | 6.86 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|