C20H17F2NO4S2 — CID 58644667
6-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 58644667) has the molecular formula C20H17F2NO4S2 and a molecular weight of 437.49 g/mol. Its IUPAC name is 6-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 58644667 |
| Molecular Formula | C20H17F2NO4S2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 6-[(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)/C(=C/c2ccc(-c3ccc(F)cc3F)o2)SC1=S |
| InChI | InChI=1S/C20H17F2NO4S2/c21-12-5-7-14(15(22)10-12)16-8-6-13(27-16)11-17-19(26)23(20(28)29-17)9-3-1-2-4-18(24)25/h5-8,10-11H,1-4,9H2,(H,24,25)/b17-11- |
| InChIKey | LBOFHYGTGLMLMN-BOPFTXTBSA-N |
| XLogP | 5.07 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|