C18H23F3NOP — CID 58644964
[2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopentyl]-[4-(trifluoromethyl)phenyl]phosphane (PubChem CID 58644964) has the molecular formula C18H23F3NOP and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopentyl]-[4-(trifluoromethyl)phenyl]phosphane.
| Compound Name | [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopentyl]-[4-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 58644964 |
| Molecular Formula | C18H23F3NOP |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopentyl]-[4-(trifluoromethyl)phenyl]phosphane |
| SMILES | CC(C)C1COC(C2CCCC2Pc2ccc(C(F)(F)F)cc2)=N1 |
| InChI | InChI=1S/C18H23F3NOP/c1-11(2)15-10-23-17(22-15)14-4-3-5-16(14)24-13-8-6-12(7-9-13)18(19,20)21/h6-9,11,14-16,24H,3-5,10H2,1-2H3 |
| InChIKey | UZPKUHHRLFYCOJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|