C13H14N2 — CID 58645346
(3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carbonitrile (PubChem CID 58645346) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carbonitrile.
| Compound Name | (3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 58645346 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carbonitrile |
| SMILES | N#Cc1cccc2c1NC[C@@H]1CCC[C@H]21 |
| InChI | InChI=1S/C13H14N2/c14-7-9-3-1-6-12-11-5-2-4-10(11)8-15-13(9)12/h1,3,6,10-11,15H,2,4-5,8H2/t10-,11-/m0/s1 |
| InChIKey | YSSMCMSVNWGYEV-QWRGUYRKSA-N |
| XLogP | 2.87 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |