C14H18N5O3WY- — CID 58645398
7-[(2R)-5-methanidyl-3,3,4-trimethyloxolan-2-yl]-5-nitropyrrolo[2,3-d]pyrimidin-4-amine;tungsten;yttrium (PubChem CID 58645398) has the molecular formula C14H18N5O3WY- and a molecular weight of 577.08 g/mol. Its IUPAC name is 7-[(2R)-5-methanidyl-3,3,4-trimethyloxolan-2-yl]-5-nitropyrrolo[2,3-d]pyrimidin-4-amine;tungsten;yttrium.
| Compound Name | 7-[(2R)-5-methanidyl-3,3,4-trimethyloxolan-2-yl]-5-nitropyrrolo[2,3-d]pyrimidin-4-amine;tungsten;yttrium |
|---|---|
| PubChem CID | 58645398 |
| Molecular Formula | C14H18N5O3WY- |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 577.00 |
| IUPAC Name | 7-[(2R)-5-methanidyl-3,3,4-trimethyloxolan-2-yl]-5-nitropyrrolo[2,3-d]pyrimidin-4-amine;tungsten;yttrium |
| SMILES | [CH2-]C1O[C@@H](n2cc([N+](=O)[O-])c3c(N)ncnc32)C(C)(C)C1C.[W].[Y] |
| InChI | InChI=1S/C14H18N5O3.W.Y/c1-7-8(2)22-13(14(7,3)4)18-5-9(19(20)21)10-11(15)16-6-17-12(10)18;;/h5-8,13H,2H2,1,3-4H3,(H2,15,16,17);;/q-1;;/t7?,8?,13-;;/m1../s1 |
| InChIKey | FRAUKFIUOVJVQS-JSLDKYNLSA-N |
| XLogP | 2.31 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|