C30H36FN3O3 — CID 58645873
(14R)-4-[3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 58645873) has the molecular formula C30H36FN3O3 and a molecular weight of 505.63 g/mol. Its IUPAC name is (14R)-4-[3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (14R)-4-[3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 58645873 |
| Molecular Formula | C30H36FN3O3 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (14R)-4-[3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]propyl]-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1OC1C[C@@H](O)C=CC31CCN(CCCN1CC3CC1CN3c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C30H36FN3O3/c1-36-26-8-3-20-17-32(14-11-30-10-9-25(35)16-27(30)37-29(26)28(20)30)12-2-13-33-18-24-15-23(33)19-34(24)22-6-4-21(31)5-7-22/h3-10,23-25,27,35H,2,11-19H2,1H3/t23?,24?,25-,27?,30?/m0/s1 |
| InChIKey | SMEJRMPIYROTBO-UVZVOWGESA-N |
| XLogP | 3.71 |
| TPSA | 48.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|