C14H17F3N4O — CID 58646073
4-(2-piperazin-1-ylethoxy)-2-(trifluoromethyl)-1H-benzimidazole (PubChem CID 58646073) has the molecular formula C14H17F3N4O and a molecular weight of 314.31 g/mol. Its IUPAC name is 4-(2-piperazin-1-ylethoxy)-2-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 4-(2-piperazin-1-ylethoxy)-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 58646073 |
| Molecular Formula | C14H17F3N4O |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-(2-piperazin-1-ylethoxy)-2-(trifluoromethyl)-1H-benzimidazole |
| SMILES | FC(F)(F)c1nc2c(OCCN3CCNCC3)cccc2[nH]1 |
| InChI | InChI=1S/C14H17F3N4O/c15-14(16,17)13-19-10-2-1-3-11(12(10)20-13)22-9-8-21-6-4-18-5-7-21/h1-3,18H,4-9H2,(H,19,20) |
| InChIKey | OZHSGXCZKXZEPP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |