C11H15N3O — CID 58646306
2,5-dimethyl-5-phenyl-6H-1,2,4-oxadiazin-3-amine (PubChem CID 58646306) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2,5-dimethyl-5-phenyl-6H-1,2,4-oxadiazin-3-amine.
| Compound Name | 2,5-dimethyl-5-phenyl-6H-1,2,4-oxadiazin-3-amine |
|---|---|
| PubChem CID | 58646306 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2,5-dimethyl-5-phenyl-6H-1,2,4-oxadiazin-3-amine |
| SMILES | CN1OCC(C)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C11H15N3O/c1-11(9-6-4-3-5-7-9)8-15-14(2)10(12)13-11/h3-7H,8H2,1-2H3,(H2,12,13) |
| InChIKey | AVRSNIGZODTAMT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |