C28H25FN2O9 — CID 58647412
2-fluoroethyl N-[4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate (PubChem CID 58647412) has the molecular formula C28H25FN2O9 and a molecular weight of 552.51 g/mol. Its IUPAC name is 2-fluoroethyl N-[4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate.
| Compound Name | 2-fluoroethyl N-[4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 58647412 |
| Molecular Formula | C28H25FN2O9 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 2-fluoroethyl N-[4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(NC(=O)OCCF)cc5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C28H25FN2O9/c29-7-8-40-27(38)31-15-3-1-12(2-4-15)16-5-6-18(32)21-17(16)10-13-9-14-11-19(33)22(26(30)37)25(36)28(14,39)24(35)20(13)23(21)34/h1-6,13-14,32,34,36,39H,7-11H2,(H2,30,37)(H,31,38)/t13-,14+,28+/m1/s1 |
| InChIKey | NGPCORGPWWNLFP-VSGRFQRGSA-N |
| XLogP | 2.61 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|