C26H25F3N4O7S — CID 58647437
(4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647437) has the molecular formula C26H25F3N4O7S and a molecular weight of 594.57 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647437 |
| Molecular Formula | C26H25F3N4O7S |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNc2nc(C(F)(F)F)cs2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C26H25F3N4O7S/c1-33(2)13-5-10(7-31-24-32-15(8-41-24)26(27,28)29)19(35)17-12(13)4-9-3-11-6-14(34)18(23(30)39)22(38)25(11,40)21(37)16(9)20(17)36/h5,8-9,11,35-36,38,40H,3-4,6-7H2,1-2H3,(H2,30,39)(H,31,32)/t9-,11+,25+/m1/s1 |
| InChIKey | LNTBUXLVJPNIEY-PDISFODASA-N |
| XLogP | 2.58 |
| TPSA | 186.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|