C25H20FNO7 — CID 58647522
(4aS,5aR,12aR)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647522) has the molecular formula C25H20FNO7 and a molecular weight of 465.43 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647522 |
| Molecular Formula | C25H20FNO7 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (4aS,5aR,12aR)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(F)cc5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C25H20FNO7/c26-13-3-1-10(2-4-13)14-5-6-16(28)19-15(14)8-11-7-12-9-17(29)20(24(27)33)23(32)25(12,34)22(31)18(11)21(19)30/h1-6,11-12,28,30,32,34H,7-9H2,(H2,27,33)/t11-,12+,25+/m1/s1 |
| InChIKey | DBIPSKZRVZCQDJ-FIRCGALFSA-N |
| XLogP | 2.23 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|