C30H29F3N4O9 — CID 58647588
(12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647588) has the molecular formula C30H29F3N4O9 and a molecular weight of 646.58 g/mol. Its IUPAC name is (12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647588 |
| Molecular Formula | C30H29F3N4O9 |
| Molecular Weight | 646.58 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | (12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]carbamoylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNC(=O)Nc2ccc(OC(F)(F)F)cc2)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H29F3N4O9/c1-37(2)18-9-13(11-35-28(44)36-15-3-5-16(6-4-15)46-30(31,32)33)23(39)21-17(18)8-12-7-14-10-19(38)22(27(34)43)26(42)29(14,45)25(41)20(12)24(21)40/h3-6,9,12,14,39-40,42,45H,7-8,10-11H2,1-2H3,(H2,34,43)(H2,35,36,44)/t12?,14?,29-/m0/s1 |
| InChIKey | PINPJBTZTDDVLR-GDRLASEISA-N |
| XLogP | 2.71 |
| TPSA | 211.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|