C29H24F3NO8 — CID 58647896
(4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647896) has the molecular formula C29H24F3NO8 and a molecular weight of 571.50 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647896 |
| Molecular Formula | C29H24F3NO8 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-9-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(/C=C/c3ccc(C(F)(F)F)cc3)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C29H24F3NO8/c1-11-15-9-6-13(5-2-12-3-7-14(8-4-12)29(30,31)32)22(35)19(15)24(37)21-18(11)23(36)16-10-17(34)20(27(33)40)25(38)28(16,41)26(21)39/h2-9,11,16,18,23,35-38,41H,10H2,1H3,(H2,33,40)/b5-2+/t11-,16+,18+,23+,28+/m0/s1 |
| InChIKey | CBRRPEHYTXBDCI-NGYYVMRRSA-N |
| XLogP | 3.14 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|